C40H35Cl2F3N2O3 — CID 71009156
N-[bis(4-methoxyphenyl)-phenylmethyl]-4-[5-(3,5-dichlorophenyl)-2-fluorophenyl]-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine (PubChem CID 71009156) has the molecular formula C40H35Cl2F3N2O3 and a molecular weight of 719.63 g/mol. Its IUPAC name is N-[bis(4-methoxyphenyl)-phenylmethyl]-4-[5-(3,5-dichlorophenyl)-2-fluorophenyl]-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine.
| Compound Name | N-[bis(4-methoxyphenyl)-phenylmethyl]-4-[5-(3,5-dichlorophenyl)-2-fluorophenyl]-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 71009156 |
| Molecular Formula | C40H35Cl2F3N2O3 |
| Molecular Weight | 719.63 g/mol |
| Exact Mass | 718.20 |
| IUPAC Name | N-[bis(4-methoxyphenyl)-phenylmethyl]-4-[5-(3,5-dichlorophenyl)-2-fluorophenyl]-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine |
| SMILES | COc1ccc(C(NC2=NC(C)(c3cc(-c4cc(Cl)cc(Cl)c4)ccc3F)C(F)(F)C(C)(C)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H35Cl2F3N2O3/c1-37(2)40(44,45)38(3,34-23-25(11-20-35(34)43)26-21-30(41)24-31(42)22-26)46-36(50-37)47-39(27-9-7-6-8-10-27,28-12-16-32(48-4)17-13-28)29-14-18-33(49-5)19-15-29/h6-24H,1-5H3,(H,46,47) |
| InChIKey | VUCBFQXZHWVOOI-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.63 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|