C12H11NO4 — CID 58317136
7,8,9,10-tetrahydro-4H-isochromeno[4,3-c]pyridine-1,3,6-trione (PubChem CID 58317136) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 7,8,9,10-tetrahydro-4H-isochromeno[4,3-c]pyridine-1,3,6-trione.
| Compound Name | 7,8,9,10-tetrahydro-4H-isochromeno[4,3-c]pyridine-1,3,6-trione |
|---|---|
| PubChem CID | 58317136 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 7,8,9,10-tetrahydro-4H-isochromeno[4,3-c]pyridine-1,3,6-trione |
| SMILES | O=C1Cc2oc(=O)c3c(c2C(=O)N1)CCCC3 |
| InChI | InChI=1S/C12H11NO4/c14-9-5-8-10(11(15)13-9)6-3-1-2-4-7(6)12(16)17-8/h1-5H2,(H,13,14,15) |
| InChIKey | YLXLAJLZGJGCTI-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|