C35H45ClNO5 — CID 58329811
CID 58329811 (PubChem CID 58329811) has the molecular formula C35H45ClNO5 and a molecular weight of 595.20 g/mol.
| Compound Name | CID 58329811 |
|---|---|
| PubChem CID | 58329811 |
| Molecular Formula | C35H45ClNO5 |
| Molecular Weight | 595.20 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | — |
| SMILES | [CH][C@@](O)(C(=O)O)[C@H](/C=C/CCCCCCC(=O)CCCCCCC)C(=O)N[CH]Cc1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C35H45ClNO5/c1-3-4-5-8-11-14-31(38)15-12-9-6-7-10-13-16-32(35(2,42)34(40)41)33(39)37-26-25-27-17-19-28(20-18-27)29-21-23-30(36)24-22-29/h2,13,16-24,26,32,42H,3-12,14-15,25H2,1H3,(H,37,39)(H,40,41)/b16-13+/t32-,35+/m1/s1 |
| InChIKey | VCWTVJLHXDHFFX-SKJNOYMISA-N |
| XLogP | 7.80 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.20 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|