C36H48NO6 — CID 58329784
CID 58329784 (PubChem CID 58329784) has the molecular formula C36H48NO6 and a molecular weight of 590.78 g/mol.
| Compound Name | CID 58329784 |
|---|---|
| PubChem CID | 58329784 |
| Molecular Formula | C36H48NO6 |
| Molecular Weight | 590.78 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | — |
| SMILES | [CH][C@@](O)(C(=O)O)[C@H](/C=C/CCCCCCC(=O)CCCCCCC)C(=O)N[CH]Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H48NO6/c1-3-4-5-8-14-19-31(38)20-15-9-6-7-10-16-21-33(36(2,42)35(40)41)34(39)37-27-26-29-22-24-32(25-23-29)43-28-30-17-12-11-13-18-30/h2,11-13,16-18,21-25,27,33,42H,3-10,14-15,19-20,26,28H2,1H3,(H,37,39)(H,40,41)/b21-16+/t33-,36+/m1/s1 |
| InChIKey | XAYPPNBKSNPRCS-NRVJBKQNSA-N |
| XLogP | 7.06 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.78 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|