C8H8F6O5 — CID 58330318
2-[[4,5-difluoro-2-methyl-2-(trifluoromethyl)-1,3-dioxolan-4-yl]oxy]ethyl carbonofluoridate (PubChem CID 58330318) has the molecular formula C8H8F6O5 and a molecular weight of 298.14 g/mol. Its IUPAC name is 2-[[4,5-difluoro-2-methyl-2-(trifluoromethyl)-1,3-dioxolan-4-yl]oxy]ethyl carbonofluoridate.
| Compound Name | 2-[[4,5-difluoro-2-methyl-2-(trifluoromethyl)-1,3-dioxolan-4-yl]oxy]ethyl carbonofluoridate |
|---|---|
| PubChem CID | 58330318 |
| Molecular Formula | C8H8F6O5 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-[[4,5-difluoro-2-methyl-2-(trifluoromethyl)-1,3-dioxolan-4-yl]oxy]ethyl carbonofluoridate |
| SMILES | CC1(C(F)(F)F)OC(F)C(F)(OCCOC(=O)F)O1 |
| InChI | InChI=1S/C8H8F6O5/c1-6(8(12,13)14)18-4(9)7(11,19-6)17-3-2-16-5(10)15/h4H,2-3H2,1H3 |
| InChIKey | XWPIYYLPZMDWPA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|