C8H7F7O5 — CID 58330322
3-[(2,2,4,5-tetrafluoro-1,3-dioxolan-4-yl)oxy]propyl 2,2,2-trifluoroacetate (PubChem CID 58330322) has the molecular formula C8H7F7O5 and a molecular weight of 316.13 g/mol. Its IUPAC name is 3-[(2,2,4,5-tetrafluoro-1,3-dioxolan-4-yl)oxy]propyl 2,2,2-trifluoroacetate.
| Compound Name | 3-[(2,2,4,5-tetrafluoro-1,3-dioxolan-4-yl)oxy]propyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 58330322 |
| Molecular Formula | C8H7F7O5 |
| Molecular Weight | 316.13 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 3-[(2,2,4,5-tetrafluoro-1,3-dioxolan-4-yl)oxy]propyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OCCCOC1(F)OC(F)(F)OC1F)C(F)(F)F |
| InChI | InChI=1S/C8H7F7O5/c9-4-7(13,20-8(14,15)19-4)18-3-1-2-17-5(16)6(10,11)12/h4H,1-3H2 |
| InChIKey | GQBHAQVQEIFKRL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.13 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|