C26H17NO — CID 58330919
4-(N-(4-hexa-1,3,5-triynylphenyl)-4-methylanilino)benzaldehyde (PubChem CID 58330919) has the molecular formula C26H17NO and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-(N-(4-hexa-1,3,5-triynylphenyl)-4-methylanilino)benzaldehyde.
| Compound Name | 4-(N-(4-hexa-1,3,5-triynylphenyl)-4-methylanilino)benzaldehyde |
|---|---|
| PubChem CID | 58330919 |
| Molecular Formula | C26H17NO |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-(N-(4-hexa-1,3,5-triynylphenyl)-4-methylanilino)benzaldehyde |
| SMILES | C#CC#CC#Cc1ccc(N(c2ccc(C)cc2)c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C26H17NO/c1-3-4-5-6-7-22-10-16-25(17-11-22)27(24-14-8-21(2)9-15-24)26-18-12-23(20-28)13-19-26/h1,8-20H,2H3 |
| InChIKey | SUMYCJKNDGLVEZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|