C18H13FO3S2 — CID 58337800
2-[2-(3-fluorophenyl)-2-oxoethyl]-4-(5-methylthiophen-2-yl)thiophene-3-carboxylic acid (PubChem CID 58337800) has the molecular formula C18H13FO3S2 and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)-2-oxoethyl]-4-(5-methylthiophen-2-yl)thiophene-3-carboxylic acid.
| Compound Name | 2-[2-(3-fluorophenyl)-2-oxoethyl]-4-(5-methylthiophen-2-yl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58337800 |
| Molecular Formula | C18H13FO3S2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 2-[2-(3-fluorophenyl)-2-oxoethyl]-4-(5-methylthiophen-2-yl)thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2csc(CC(=O)c3cccc(F)c3)c2C(=O)O)s1 |
| InChI | InChI=1S/C18H13FO3S2/c1-10-5-6-15(24-10)13-9-23-16(17(13)18(21)22)8-14(20)11-3-2-4-12(19)7-11/h2-7,9H,8H2,1H3,(H,21,22) |
| InChIKey | VRHQVKDTQCXMPU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |