C11H19N6O+ — CID 58338706
2-amino-9-tert-butyl-7-ethanimidoyl-4,5-dihydro-1H-purin-9-ium-6-one (PubChem CID 58338706) has the molecular formula C11H19N6O+ and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-amino-9-tert-butyl-7-ethanimidoyl-4,5-dihydro-1H-purin-9-ium-6-one.
| Compound Name | 2-amino-9-tert-butyl-7-ethanimidoyl-4,5-dihydro-1H-purin-9-ium-6-one |
|---|---|
| PubChem CID | 58338706 |
| Molecular Formula | C11H19N6O+ |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 2-amino-9-tert-butyl-7-ethanimidoyl-4,5-dihydro-1H-purin-9-ium-6-one |
| SMILES | [H]/N=C(\C)N1C=[N+](C(C)(C)C)C2N=C(N)NC(=O)C21 |
| InChI | InChI=1S/C11H18N6O/c1-6(12)16-5-17(11(2,3)4)8-7(16)9(18)15-10(13)14-8/h5,7-8,12H,1-4H3,(H2-,13,14,15,18)/p+1/b12-6+ |
| InChIKey | BUUVCHGJFKFCRF-WUXMJOGZSA-O |
| XLogP | -0.72 |
| TPSA | 97.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|