C25H29Cl2NO4S2 — CID 58360879
(2R,3R,4S,5R)-5-butyl-2-(3,4-dichlorophenyl)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpyrrolidine-3-carboxylic acid (PubChem CID 58360879) has the molecular formula C25H29Cl2NO4S2 and a molecular weight of 542.55 g/mol. Its IUPAC name is (2R,3R,4S,5R)-5-butyl-2-(3,4-dichlorophenyl)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3R,4S,5R)-5-butyl-2-(3,4-dichlorophenyl)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 58360879 |
| Molecular Formula | C25H29Cl2NO4S2 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | (2R,3R,4S,5R)-5-butyl-2-(3,4-dichlorophenyl)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpyrrolidine-3-carboxylic acid |
| SMILES | C=CCS[C@H]1[C@@H](C(=O)O)[C@H](c2ccc(Cl)c(Cl)c2)N(S(=O)(=O)c2ccc(C)cc2)[C@@H]1CCCC |
| InChI | InChI=1S/C25H29Cl2NO4S2/c1-4-6-7-21-24(33-14-5-2)22(25(29)30)23(17-10-13-19(26)20(27)15-17)28(21)34(31,32)18-11-8-16(3)9-12-18/h5,8-13,15,21-24H,2,4,6-7,14H2,1,3H3,(H,29,30)/t21-,22+,23+,24-/m1/s1 |
| InChIKey | NNWHNHFSGBYETF-NAVOZUGXSA-N |
| XLogP | 6.59 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|