C15H18F2O2 — CID 58372434
(4-phenylcyclohexyl) 2,2-difluoropropanoate (PubChem CID 58372434) has the molecular formula C15H18F2O2 and a molecular weight of 268.30 g/mol. Its IUPAC name is (4-phenylcyclohexyl) 2,2-difluoropropanoate.
| Compound Name | (4-phenylcyclohexyl) 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 58372434 |
| Molecular Formula | C15H18F2O2 |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (4-phenylcyclohexyl) 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OC1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C15H18F2O2/c1-15(16,17)14(18)19-13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3 |
| InChIKey | LCRFXGQLMIVUDD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |