C16H23F9O4 — CID 58388546
2-[3-(1-ethoxyethoxy)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 58388546) has the molecular formula C16H23F9O4 and a molecular weight of 450.34 g/mol. Its IUPAC name is 2-[3-(1-ethoxyethoxy)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[3-(1-ethoxyethoxy)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 58388546 |
| Molecular Formula | C16H23F9O4 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 2-[3-(1-ethoxyethoxy)-5-(1,1,1-trifluoro-2-hydroxypropan-2-yl)cyclohexyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCOC(C)OC1CC(C(C)(O)C(F)(F)F)CC(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C16H23F9O4/c1-4-28-8(2)29-11-6-9(12(3,26)14(17,18)19)5-10(7-11)13(27,15(20,21)22)16(23,24)25/h8-11,26-27H,4-7H2,1-3H3 |
| InChIKey | WGNMDUZFHZKWQQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|