C15H25NO6 — CID 58402366
N-[2-hydroxy-3-[2-(2-hydroxy-5-oxohept-6-enoxy)ethoxy]propyl]prop-2-enamide (PubChem CID 58402366) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[2-hydroxy-3-[2-(2-hydroxy-5-oxohept-6-enoxy)ethoxy]propyl]prop-2-enamide.
| Compound Name | N-[2-hydroxy-3-[2-(2-hydroxy-5-oxohept-6-enoxy)ethoxy]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 58402366 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-[2-hydroxy-3-[2-(2-hydroxy-5-oxohept-6-enoxy)ethoxy]propyl]prop-2-enamide |
| SMILES | C=CC(=O)CCC(O)COCCOCC(O)CNC(=O)C=C |
| InChI | InChI=1S/C15H25NO6/c1-3-12(17)5-6-13(18)10-21-7-8-22-11-14(19)9-16-15(20)4-2/h3-4,13-14,18-19H,1-2,5-11H2,(H,16,20) |
| InChIKey | YHMSYWSBDDOURP-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|