C29H46F6O7 — CID 58403297
3-O-(1-ethylcyclopentyl) 1-O-(2,2,2-trifluoroethyl) 5-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 58403297) has the molecular formula C29H46F6O7 and a molecular weight of 620.67 g/mol. Its IUPAC name is 3-O-(1-ethylcyclopentyl) 1-O-(2,2,2-trifluoroethyl) 5-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(1-ethylcyclopentyl) 1-O-(2,2,2-trifluoroethyl) 5-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 58403297 |
| Molecular Formula | C29H46F6O7 |
| Molecular Weight | 620.67 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | 3-O-(1-ethylcyclopentyl) 1-O-(2,2,2-trifluoroethyl) 5-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC1(OC(=O)C(C)(CC(C)(C)C(=O)OCC(F)(F)F)CC(C)(CC)C(=O)OC(C)CC(C)(O)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C29H46F6O7/c1-9-24(6,21(37)41-19(3)15-26(8,39)29(33,34)35)17-25(7,22(38)42-27(10-2)13-11-12-14-27)16-23(4,5)20(36)40-18-28(30,31)32/h19,39H,9-18H2,1-8H3 |
| InChIKey | XYPLMJBSZFGSJT-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.67 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|