C11H23O38Si37 — CID 58412133
CID 58412133 (PubChem CID 58412133) has the molecular formula C11H23O38Si37 and a molecular weight of 1802.45 g/mol.
| Compound Name | CID 58412133 |
|---|---|
| PubChem CID | 58412133 |
| Molecular Formula | C11H23O38Si37 |
| Molecular Weight | 1802.45 g/mol |
| Exact Mass | 1798.13 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)O[Si](C)(C)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si]=O |
| InChI | InChI=1S/C11H23O38Si37/c1-10(2)11(12)48-8-7-9-85(3,4)49-86(5,6)84(47)83(46)82(45)81(44)80(43)79(42)78(41)77(40)76(39)75(38)74(37)73(36)72(35)71(34)70(33)69(32)68(31)67(30)66(29)65(28)64(27)63(26)62(25)61(24)60(23)59(22)58(21)57(20)56(19)55(18)54(17)53(16)52(15)51(14)50-13/h1,7-9H2,2-6H3 |
| InChIKey | VVWYEFBCEZLEPR-UHFFFAOYSA-N |
| XLogP | -14.52 |
| TPSA | 632.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 38 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1802.45 |
| LogP ≤ 5 | -14.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 38 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|