C9H17O37Si35 — CID 58412146
CID 58412146 (PubChem CID 58412146) has the molecular formula C9H17O37Si35 and a molecular weight of 1700.21 g/mol.
| Compound Name | CID 58412146 |
|---|---|
| PubChem CID | 58412146 |
| Molecular Formula | C9H17O37Si35 |
| Molecular Weight | 1700.21 g/mol |
| Exact Mass | 1696.14 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)O[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si](=O)[Si]=O |
| InChI | InChI=1S/C9H17O37Si35/c1-8(2)9(10)45-6-5-7-81(3,4)46-48(12)50(14)52(16)54(18)56(20)58(22)60(24)62(26)64(28)66(30)68(32)70(34)72(36)74(38)76(40)78(42)80(44)79(43)77(41)75(39)73(37)71(35)69(33)67(31)65(29)63(27)61(25)59(23)57(21)55(19)53(17)51(15)49(13)47-11/h1,5-7H2,2-4H3 |
| InChIKey | SXJXPRFKJRSMFC-UHFFFAOYSA-N |
| XLogP | -14.80 |
| TPSA | 615.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 37 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1700.21 |
| LogP ≤ 5 | -14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 37 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|