C14H16N4O — CID 58426321
(2E,4E)-5-[bis(isocyanomethyl)amino]-2-(2,2-dimethylpropanoyl)penta-2,4-dienenitrile (PubChem CID 58426321) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is (2E,4E)-5-[bis(isocyanomethyl)amino]-2-(2,2-dimethylpropanoyl)penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-[bis(isocyanomethyl)amino]-2-(2,2-dimethylpropanoyl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 58426321 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (2E,4E)-5-[bis(isocyanomethyl)amino]-2-(2,2-dimethylpropanoyl)penta-2,4-dienenitrile |
| SMILES | [C-]#[N+]CN(/C=C/C=C(\C#N)C(=O)C(C)(C)C)C[N+]#[C-] |
| InChI | InChI=1S/C14H16N4O/c1-14(2,3)13(19)12(9-15)7-6-8-18(10-16-4)11-17-5/h6-8H,10-11H2,1-3H3/b8-6+,12-7+ |
| InChIKey | PHMZDANCRSTPMJ-ULBORTECSA-N |
| XLogP | 2.62 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|