C36H40O3 — CID 58426751
2-[[3,5-bis(1-phenylethyl)phenyl]-phenylmethoxy]ethyl 2-methylbutanoate (PubChem CID 58426751) has the molecular formula C36H40O3 and a molecular weight of 520.71 g/mol. Its IUPAC name is 2-[[3,5-bis(1-phenylethyl)phenyl]-phenylmethoxy]ethyl 2-methylbutanoate.
| Compound Name | 2-[[3,5-bis(1-phenylethyl)phenyl]-phenylmethoxy]ethyl 2-methylbutanoate |
|---|---|
| PubChem CID | 58426751 |
| Molecular Formula | C36H40O3 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 2-[[3,5-bis(1-phenylethyl)phenyl]-phenylmethoxy]ethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCOC(c1ccccc1)c1cc(C(C)c2ccccc2)cc(C(C)c2ccccc2)c1 |
| InChI | InChI=1S/C36H40O3/c1-5-26(2)36(37)39-22-21-38-35(31-19-13-8-14-20-31)34-24-32(27(3)29-15-9-6-10-16-29)23-33(25-34)28(4)30-17-11-7-12-18-30/h6-20,23-28,35H,5,21-22H2,1-4H3 |
| InChIKey | YMFMSNKAOJJLKK-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|