C21H27FO5S2 — CID 58445739
2-(1-adamantyl)propan-2-yl 2-(4-fluorosulfonyloxyphenyl)sulfanylacetate (PubChem CID 58445739) has the molecular formula C21H27FO5S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 2-(1-adamantyl)propan-2-yl 2-(4-fluorosulfonyloxyphenyl)sulfanylacetate.
| Compound Name | 2-(1-adamantyl)propan-2-yl 2-(4-fluorosulfonyloxyphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 58445739 |
| Molecular Formula | C21H27FO5S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-(1-adamantyl)propan-2-yl 2-(4-fluorosulfonyloxyphenyl)sulfanylacetate |
| SMILES | CC(C)(OC(=O)CSc1ccc(OS(=O)(=O)F)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H27FO5S2/c1-20(2,21-10-14-7-15(11-21)9-16(8-14)12-21)26-19(23)13-28-18-5-3-17(4-6-18)27-29(22,24)25/h3-6,14-16H,7-13H2,1-2H3 |
| InChIKey | OKFHOVGZALNWGZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |