C15H24IN3O2 — CID 58464113
tert-butyl N-[4-[(5-iodo-2-pyridinyl)amino]-2-methylbutan-2-yl]carbamate (PubChem CID 58464113) has the molecular formula C15H24IN3O2 and a molecular weight of 405.28 g/mol. Its IUPAC name is tert-butyl N-[4-[(5-iodo-2-pyridinyl)amino]-2-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(5-iodo-2-pyridinyl)amino]-2-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58464113 |
| Molecular Formula | C15H24IN3O2 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | tert-butyl N-[4-[(5-iodo-2-pyridinyl)amino]-2-methylbutan-2-yl]carbamate |
| SMILES | CC(C)(CCNc1ccc(I)cn1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H24IN3O2/c1-14(2,3)21-13(20)19-15(4,5)8-9-17-12-7-6-11(16)10-18-12/h6-7,10H,8-9H2,1-5H3,(H,17,18)(H,19,20) |
| InChIKey | JXPGHMMHNMMAFH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|