C7H14N2 — CID 58473777
5-propan-2-yl-1,4,5,6-tetrahydropyridazine (PubChem CID 58473777) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 5-propan-2-yl-1,4,5,6-tetrahydropyridazine.
| Compound Name | 5-propan-2-yl-1,4,5,6-tetrahydropyridazine |
|---|---|
| PubChem CID | 58473777 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 5-propan-2-yl-1,4,5,6-tetrahydropyridazine |
| SMILES | CC(C)C1CC=NNC1 |
| InChI | InChI=1S/C7H14N2/c1-6(2)7-3-4-8-9-5-7/h4,6-7,9H,3,5H2,1-2H3 |
| InChIKey | FRSLXFCULZGFAN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |