C20H26O3 — CID 58481512
4-[(2-methyloxolan-3-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 58481512) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-[(2-methyloxolan-3-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-[(2-methyloxolan-3-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 58481512 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 4-[(2-methyloxolan-3-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC3CCOC3C)C2=O)c(C)c1 |
| InChI | InChI=1S/C20H26O3/c1-11-7-12(2)18(13(3)8-11)19-17(21)10-16(20(19)22)9-15-5-6-23-14(15)4/h7-8,14-16,19H,5-6,9-10H2,1-4H3 |
| InChIKey | DESUNIYGVGQGSJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|