C61H67N3O2S2 — CID 58500512
2-[5-[2,3-bis(4-methoxyphenyl)-8-(5-methylthiophen-2-yl)quinoxalin-5-yl]thiophen-2-yl]-9-heptadecan-9-yl-7-methylcarbazole (PubChem CID 58500512) has the molecular formula C61H67N3O2S2 and a molecular weight of 938.36 g/mol. Its IUPAC name is 2-[5-[2,3-bis(4-methoxyphenyl)-8-(5-methylthiophen-2-yl)quinoxalin-5-yl]thiophen-2-yl]-9-heptadecan-9-yl-7-methylcarbazole.
| Compound Name | 2-[5-[2,3-bis(4-methoxyphenyl)-8-(5-methylthiophen-2-yl)quinoxalin-5-yl]thiophen-2-yl]-9-heptadecan-9-yl-7-methylcarbazole |
|---|---|
| PubChem CID | 58500512 |
| Molecular Formula | C61H67N3O2S2 |
| Molecular Weight | 938.36 g/mol |
| Exact Mass | 937.47 |
| IUPAC Name | 2-[5-[2,3-bis(4-methoxyphenyl)-8-(5-methylthiophen-2-yl)quinoxalin-5-yl]thiophen-2-yl]-9-heptadecan-9-yl-7-methylcarbazole |
| SMILES | CCCCCCCCC(CCCCCCCC)n1c2cc(C)ccc2c2ccc(-c3ccc(-c4ccc(-c5ccc(C)s5)c5nc(-c6ccc(OC)cc6)c(-c6ccc(OC)cc6)nc45)s3)cc21 |
| InChI | InChI=1S/C61H67N3O2S2/c1-7-9-11-13-15-17-19-46(20-18-16-14-12-10-8-2)64-53-39-41(3)21-32-49(53)50-33-27-45(40-54(50)64)55-37-38-57(68-55)52-35-34-51(56-36-22-42(4)67-56)60-61(52)63-59(44-25-30-48(66-6)31-26-44)58(62-60)43-23-28-47(65-5)29-24-43/h21-40,46H,7-20H2,1-6H3 |
| InChIKey | ZVOSABGJGOHCDU-UHFFFAOYSA-N |
| XLogP | 18.87 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.36 |
| LogP ≤ 5 | 18.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|