C44H48F2N2O2S2 — CID 142722003
6,7-difluoro-2,3-bis(4-octoxyphenyl)-5,8-dithiophen-2-ylquinoxaline (PubChem CID 142722003) has the molecular formula C44H48F2N2O2S2 and a molecular weight of 739.01 g/mol. Its IUPAC name is 6,7-difluoro-2,3-bis(4-octoxyphenyl)-5,8-dithiophen-2-ylquinoxaline.
| Compound Name | 6,7-difluoro-2,3-bis(4-octoxyphenyl)-5,8-dithiophen-2-ylquinoxaline |
|---|---|
| PubChem CID | 142722003 |
| Molecular Formula | C44H48F2N2O2S2 |
| Molecular Weight | 739.01 g/mol |
| Exact Mass | 738.31 |
| IUPAC Name | 6,7-difluoro-2,3-bis(4-octoxyphenyl)-5,8-dithiophen-2-ylquinoxaline |
| SMILES | CCCCCCCCOc1ccc(-c2nc3c(-c4cccs4)c(F)c(F)c(-c4cccs4)c3nc2-c2ccc(OCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C44H48F2N2O2S2/c1-3-5-7-9-11-13-27-49-33-23-19-31(20-24-33)41-42(32-21-25-34(26-22-32)50-28-14-12-10-8-6-4-2)48-44-38(36-18-16-30-52-36)40(46)39(45)37(43(44)47-41)35-17-15-29-51-35/h15-26,29-30H,3-14,27-28H2,1-2H3 |
| InChIKey | IAWYSNIAKCIDFW-UHFFFAOYSA-N |
| XLogP | 14.18 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.01 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|