C28H35N3O3 — CID 58502502
3-[6-[5-(7,7-dimethyl-6,8-dihydro-5H-isoquinolin-4-yl)-1,2,4-oxadiazol-3-yl]-3,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propane-1,2-diol (PubChem CID 58502502) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is 3-[6-[5-(7,7-dimethyl-6,8-dihydro-5H-isoquinolin-4-yl)-1,2,4-oxadiazol-3-yl]-3,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propane-1,2-diol.
| Compound Name | 3-[6-[5-(7,7-dimethyl-6,8-dihydro-5H-isoquinolin-4-yl)-1,2,4-oxadiazol-3-yl]-3,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 58502502 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 3-[6-[5-(7,7-dimethyl-6,8-dihydro-5H-isoquinolin-4-yl)-1,2,4-oxadiazol-3-yl]-3,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]propane-1,2-diol |
| SMILES | Cc1cc(-c2noc(-c3cncc4c3CCC(C)(C)C4)n2)cc2c1CC(CC(O)CO)C(C)C2 |
| InChI | InChI=1S/C28H35N3O3/c1-16-7-19-9-20(8-17(2)24(19)11-18(16)10-22(33)15-32)26-30-27(34-31-26)25-14-29-13-21-12-28(3,4)6-5-23(21)25/h8-9,13-14,16,18,22,32-33H,5-7,10-12,15H2,1-4H3 |
| InChIKey | NFWXGLFFWXKBTG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |