C21H24FN3OS — CID 58506967
4-cyclohexyl-3-(5-fluoro-3-imino-1H-isoindol-2-yl)-1-(1,3-thiazol-2-yl)butan-2-one (PubChem CID 58506967) has the molecular formula C21H24FN3OS and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-cyclohexyl-3-(5-fluoro-3-imino-1H-isoindol-2-yl)-1-(1,3-thiazol-2-yl)butan-2-one.
| Compound Name | 4-cyclohexyl-3-(5-fluoro-3-imino-1H-isoindol-2-yl)-1-(1,3-thiazol-2-yl)butan-2-one |
|---|---|
| PubChem CID | 58506967 |
| Molecular Formula | C21H24FN3OS |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 4-cyclohexyl-3-(5-fluoro-3-imino-1H-isoindol-2-yl)-1-(1,3-thiazol-2-yl)butan-2-one |
| SMILES | [H]/N=C1\c2cc(F)ccc2CN1C(CC1CCCCC1)C(=O)Cc1nccs1 |
| InChI | InChI=1S/C21H24FN3OS/c22-16-7-6-15-13-25(21(23)17(15)11-16)18(10-14-4-2-1-3-5-14)19(26)12-20-24-8-9-27-20/h6-9,11,14,18,23H,1-5,10,12-13H2/b23-21+ |
| InChIKey | YRIOUJJEPUJDAS-XTQSDGFTSA-N |
| XLogP | 4.57 |
| TPSA | 57.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|