C23H32O7S — CID 58519041
methyl (5S,6R)-6-[(2S,3R)-3,4-diacetyloxybutan-2-yl]-4,5-dimethyl-2-phenylsulfanyloxane-2-carboxylate (PubChem CID 58519041) has the molecular formula C23H32O7S and a molecular weight of 452.57 g/mol. Its IUPAC name is methyl (5S,6R)-6-[(2S,3R)-3,4-diacetyloxybutan-2-yl]-4,5-dimethyl-2-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (5S,6R)-6-[(2S,3R)-3,4-diacetyloxybutan-2-yl]-4,5-dimethyl-2-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 58519041 |
| Molecular Formula | C23H32O7S |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | methyl (5S,6R)-6-[(2S,3R)-3,4-diacetyloxybutan-2-yl]-4,5-dimethyl-2-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)C1(Sc2ccccc2)CC(C)[C@H](C)[C@H]([C@H](C)[C@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C23H32O7S/c1-14-12-23(22(26)27-6,31-19-10-8-7-9-11-19)30-21(15(14)2)16(3)20(29-18(5)25)13-28-17(4)24/h7-11,14-16,20-21H,12-13H2,1-6H3/t14?,15-,16+,20-,21+,23?/m0/s1 |
| InChIKey | KLAIADKVYSKHIL-CIWYYLSVSA-N |
| XLogP | 3.84 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|