C17H32OSi — CID 58529099
tert-butyl-dimethyl-[(1R,3R,5Z)-3-methyl-2-methylidene-5-propylidenecyclohexyl]oxysilane (PubChem CID 58529099) has the molecular formula C17H32OSi and a molecular weight of 280.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,3R,5Z)-3-methyl-2-methylidene-5-propylidenecyclohexyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,3R,5Z)-3-methyl-2-methylidene-5-propylidenecyclohexyl]oxysilane |
|---|---|
| PubChem CID | 58529099 |
| Molecular Formula | C17H32OSi |
| Molecular Weight | 280.53 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,3R,5Z)-3-methyl-2-methylidene-5-propylidenecyclohexyl]oxysilane |
| SMILES | C=C1[C@H](C)C/C(=C/CC)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32OSi/c1-9-10-15-11-13(2)14(3)16(12-15)18-19(7,8)17(4,5)6/h10,13,16H,3,9,11-12H2,1-2,4-8H3/b15-10-/t13-,16-/m1/s1 |
| InChIKey | HPXQFBJFUSUPFQ-NYIQUGIWSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|