About 4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine
4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine (PubChem CID 58536481) has the molecular formula C15H19N
and a molecular weight of 213.32 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine |
| PubChem CID | 58536481 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine |
| SMILES | C/C=C/NC1C=CC(C2C=CC=CC2)=CC1 |
| InChI | InChI=1S/C15H19N/c1-2-12-16-15-10-8-14(9-11-15)13-6-4-3-5-7-13/h2-6,8-10,12-13,15-16H,7,11H2,1H3/b12-2+ |
| InChIKey | AHXCJYJZMGZORO-SWGQDTFXSA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine?
The IUPAC name of 4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine (CID 58536481) is 4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine is C/C=C/NC1C=CC(C2C=CC=CC2)=CC1.
What is the InChIKey of 4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine?
The InChIKey is AHXCJYJZMGZORO-SWGQDTFXSA-N. The full InChI is InChI=1S/C15H19N/c1-2-12-16-15-10-8-14(9-11-15)13-6-4-3-5-7-13/h2-6,8-10,12-13,15-16H,7,11H2,1H3/b12-2+.
What are the key properties of 4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine?
4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine has a molecular weight of 213.32 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-2,4-dien-1-yl-N-[(E)-prop-1-enyl]cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 58536481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).