C20H17NO4S — CID 58541221
2-[2-[2-oxo-3-(2-phenoxyphenyl)propyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 58541221) has the molecular formula C20H17NO4S and a molecular weight of 367.43 g/mol. Its IUPAC name is 2-[2-[2-oxo-3-(2-phenoxyphenyl)propyl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[2-oxo-3-(2-phenoxyphenyl)propyl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 58541221 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 2-[2-[2-oxo-3-(2-phenoxyphenyl)propyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(CC(=O)Cc2ccccc2Oc2ccccc2)n1 |
| InChI | InChI=1S/C20H17NO4S/c22-16(12-19-21-15(13-26-19)11-20(23)24)10-14-6-4-5-9-18(14)25-17-7-2-1-3-8-17/h1-9,13H,10-12H2,(H,23,24) |
| InChIKey | CNABVIKTMZNHBT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |