C37H72N2O9S+2 — CID 58545258
2-carboxyethyl-[9-(2,2-dimethylpropyl)-13-[dimethyl(2-sulfoethyl)azaniumyl]-5-ethyl-7-(4-methoxybutanoyl)-5,7,9-trimethyl-4,10-dioxotridecyl]-dimethylazanium (PubChem CID 58545258) has the molecular formula C37H72N2O9S+2 and a molecular weight of 721.05 g/mol. Its IUPAC name is 2-carboxyethyl-[9-(2,2-dimethylpropyl)-13-[dimethyl(2-sulfoethyl)azaniumyl]-5-ethyl-7-(4-methoxybutanoyl)-5,7,9-trimethyl-4,10-dioxotridecyl]-dimethylazanium.
| Compound Name | 2-carboxyethyl-[9-(2,2-dimethylpropyl)-13-[dimethyl(2-sulfoethyl)azaniumyl]-5-ethyl-7-(4-methoxybutanoyl)-5,7,9-trimethyl-4,10-dioxotridecyl]-dimethylazanium |
|---|---|
| PubChem CID | 58545258 |
| Molecular Formula | C37H72N2O9S+2 |
| Molecular Weight | 721.05 g/mol |
| Exact Mass | 720.49 |
| IUPAC Name | 2-carboxyethyl-[9-(2,2-dimethylpropyl)-13-[dimethyl(2-sulfoethyl)azaniumyl]-5-ethyl-7-(4-methoxybutanoyl)-5,7,9-trimethyl-4,10-dioxotridecyl]-dimethylazanium |
| SMILES | CCC(C)(CC(C)(CC(C)(CC(C)(C)C)C(=O)CCC[N+](C)(C)CCS(=O)(=O)O)C(=O)CCCOC)C(=O)CCC[N+](C)(C)CCC(=O)O |
| InChI | InChI=1S/C37H70N2O9S/c1-13-35(5,30(40)17-14-21-38(8,9)23-20-33(43)44)28-37(7,32(42)19-16-25-48-12)29-36(6,27-34(2,3)4)31(41)18-15-22-39(10,11)24-26-49(45,46)47/h13-29H2,1-12H3/p+2 |
| InChIKey | HKFUCBIODOMCLQ-UHFFFAOYSA-P |
| XLogP | 5.84 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.05 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|