C37H70N2O9S — CID 58545257
3-[[9-(2,2-dimethylpropyl)-13-[dimethyl(2-sulfonatoethyl)azaniumyl]-5-ethyl-7-(4-methoxybutanoyl)-5,7,9-trimethyl-4,10-dioxotridecyl]-dimethylazaniumyl]propanoate (PubChem CID 58545257) has the molecular formula C37H70N2O9S and a molecular weight of 719.04 g/mol. Its IUPAC name is 3-[[9-(2,2-dimethylpropyl)-13-[dimethyl(2-sulfonatoethyl)azaniumyl]-5-ethyl-7-(4-methoxybutanoyl)-5,7,9-trimethyl-4,10-dioxotridecyl]-dimethylazaniumyl]propanoate.
| Compound Name | 3-[[9-(2,2-dimethylpropyl)-13-[dimethyl(2-sulfonatoethyl)azaniumyl]-5-ethyl-7-(4-methoxybutanoyl)-5,7,9-trimethyl-4,10-dioxotridecyl]-dimethylazaniumyl]propanoate |
|---|---|
| PubChem CID | 58545257 |
| Molecular Formula | C37H70N2O9S |
| Molecular Weight | 719.04 g/mol |
| Exact Mass | 718.48 |
| IUPAC Name | 3-[[9-(2,2-dimethylpropyl)-13-[dimethyl(2-sulfonatoethyl)azaniumyl]-5-ethyl-7-(4-methoxybutanoyl)-5,7,9-trimethyl-4,10-dioxotridecyl]-dimethylazaniumyl]propanoate |
| SMILES | CCC(C)(CC(C)(CC(C)(CC(C)(C)C)C(=O)CCC[N+](C)(C)CCS(=O)(=O)[O-])C(=O)CCCOC)C(=O)CCC[N+](C)(C)CCC(=O)[O-] |
| InChI | InChI=1S/C37H70N2O9S/c1-13-35(5,30(40)17-14-21-38(8,9)23-20-33(43)44)28-37(7,32(42)19-16-25-48-12)29-36(6,27-34(2,3)4)31(41)18-15-22-39(10,11)24-26-49(45,46)47/h13-29H2,1-12H3 |
| InChIKey | HKFUCBIODOMCLQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 157.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.04 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|