C31H38F3N2O3+ — CID 58549118
[(2S,4R)-2-(4,4-difluorocyclohexyl)-4-(2-fluorophenyl)piperidin-1-yl]-[(3'S,4R)-8-methoxyspiro[2,3-dihydrochromene-4,4'-pyrrolidin-1-ium]-3'-yl]methanone (PubChem CID 58549118) has the molecular formula C31H38F3N2O3+ and a molecular weight of 543.65 g/mol. Its IUPAC name is [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-(2-fluorophenyl)piperidin-1-yl]-[(3'S,4R)-8-methoxyspiro[2,3-dihydrochromene-4,4'-pyrrolidin-1-ium]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-(2-fluorophenyl)piperidin-1-yl]-[(3'S,4R)-8-methoxyspiro[2,3-dihydrochromene-4,4'-pyrrolidin-1-ium]-3'-yl]methanone |
|---|---|
| PubChem CID | 58549118 |
| Molecular Formula | C31H38F3N2O3+ |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-(2-fluorophenyl)piperidin-1-yl]-[(3'S,4R)-8-methoxyspiro[2,3-dihydrochromene-4,4'-pyrrolidin-1-ium]-3'-yl]methanone |
| SMILES | COc1cccc2c1OCC[C@]21C[NH2+]C[C@H]1C(=O)N1CC[C@@H](c2ccccc2F)C[C@H]1C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C31H37F3N2O3/c1-38-27-8-4-6-23-28(27)39-16-14-30(23)19-35-18-24(30)29(37)36-15-11-21(22-5-2-3-7-25(22)32)17-26(36)20-9-12-31(33,34)13-10-20/h2-8,20-21,24,26,35H,9-19H2,1H3/p+1/t21-,24+,26+,30+/m1/s1 |
| InChIKey | LVDKNCRRYZUIEE-DYIQGJBUSA-O |
| XLogP | 4.65 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |