C32H40F3N2O3+ — CID 58549418
[(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4R)-8-(2,2,2-trifluoroethoxy)spiro[2,3-dihydrochromene-4,4'-pyrrolidin-1-ium]-3'-yl]methanone (PubChem CID 58549418) has the molecular formula C32H40F3N2O3+ and a molecular weight of 557.68 g/mol. Its IUPAC name is [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4R)-8-(2,2,2-trifluoroethoxy)spiro[2,3-dihydrochromene-4,4'-pyrrolidin-1-ium]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4R)-8-(2,2,2-trifluoroethoxy)spiro[2,3-dihydrochromene-4,4'-pyrrolidin-1-ium]-3'-yl]methanone |
|---|---|
| PubChem CID | 58549418 |
| Molecular Formula | C32H40F3N2O3+ |
| Molecular Weight | 557.68 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4R)-8-(2,2,2-trifluoroethoxy)spiro[2,3-dihydrochromene-4,4'-pyrrolidin-1-ium]-3'-yl]methanone |
| SMILES | O=C([C@@H]1C[NH2+]C[C@]12CCOc1c(OCC(F)(F)F)cccc12)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C32H39F3N2O3/c33-32(34,35)21-40-28-13-7-12-25-29(28)39-17-15-31(25)20-36-19-26(31)30(38)37-16-14-24(22-8-3-1-4-9-22)18-27(37)23-10-5-2-6-11-23/h1,3-4,7-9,12-13,23-24,26-27,36H,2,5-6,10-11,14-21H2/p+1/t24-,26+,27+,31+/m1/s1 |
| InChIKey | XFPAHQSQFZCPIE-IUZLCTNASA-O |
| XLogP | 5.20 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.68 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |