C22H36N3O3P — CID 58560416
benzyl (2S,5R)-5-amino-8-[(1-amino-2-dimethylphosphanylethylidene)amino]-4-oxo-2-propan-2-yloctanoate (PubChem CID 58560416) has the molecular formula C22H36N3O3P and a molecular weight of 421.52 g/mol. Its IUPAC name is benzyl (2S,5R)-5-amino-8-[(1-amino-2-dimethylphosphanylethylidene)amino]-4-oxo-2-propan-2-yloctanoate.
| Compound Name | benzyl (2S,5R)-5-amino-8-[(1-amino-2-dimethylphosphanylethylidene)amino]-4-oxo-2-propan-2-yloctanoate |
|---|---|
| PubChem CID | 58560416 |
| Molecular Formula | C22H36N3O3P |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | benzyl (2S,5R)-5-amino-8-[(1-amino-2-dimethylphosphanylethylidene)amino]-4-oxo-2-propan-2-yloctanoate |
| SMILES | CC(C)[C@H](CC(=O)[C@H](N)CCC/N=C(/N)CP(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H36N3O3P/c1-16(2)18(22(27)28-14-17-9-6-5-7-10-17)13-20(26)19(23)11-8-12-25-21(24)15-29(3)4/h5-7,9-10,16,18-19H,8,11-15,23H2,1-4H3,(H2,24,25)/t18-,19+/m0/s1 |
| InChIKey | SHATZDRLKYJTHW-RBUKOAKNSA-N |
| XLogP | 3.17 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|