C31H50N8O8 — CID 67865606
(3S)-3-[[(2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-6-[[(1S)-1-carboxy-2-phenylethyl]carbamoyl]-7-methyl-4-oxooctanoic acid (PubChem CID 67865606) has the molecular formula C31H50N8O8 and a molecular weight of 662.79 g/mol. Its IUPAC name is (3S)-3-[[(2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-6-[[(1S)-1-carboxy-2-phenylethyl]carbamoyl]-7-methyl-4-oxooctanoic acid.
| Compound Name | (3S)-3-[[(2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-6-[[(1S)-1-carboxy-2-phenylethyl]carbamoyl]-7-methyl-4-oxooctanoic acid |
|---|---|
| PubChem CID | 67865606 |
| Molecular Formula | C31H50N8O8 |
| Molecular Weight | 662.79 g/mol |
| Exact Mass | 662.38 |
| IUPAC Name | (3S)-3-[[(2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-6-[[(1S)-1-carboxy-2-phenylethyl]carbamoyl]-7-methyl-4-oxooctanoic acid |
| SMILES | CC(C)C(CC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C31H50N8O8/c1-18(2)20(27(43)39-24(30(46)47)15-19-9-4-3-5-10-19)16-25(40)23(17-26(41)42)38-29(45)22(12-6-7-13-32)37-28(44)21(33)11-8-14-36-31(34)35/h3-5,9-10,18,20-24H,6-8,11-17,32-33H2,1-2H3,(H,37,44)(H,38,45)(H,39,43)(H,41,42)(H,46,47)(H4,34,35,36)/t20?,21-,22-,23-,24-/m0/s1 |
| InChIKey | ZAGYVSGPIRPRAM-RJBWIWMOSA-N |
| XLogP | -1.02 |
| TPSA | 295.41 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.79 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|