C19H19F4O8S2- — CID 58571906
2-[2-(6-butan-2-ylnaphthalene-2-carbonyl)oxyethoxysulfonyl]-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 58571906) has the molecular formula C19H19F4O8S2- and a molecular weight of 515.48 g/mol. Its IUPAC name is 2-[2-(6-butan-2-ylnaphthalene-2-carbonyl)oxyethoxysulfonyl]-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 2-[2-(6-butan-2-ylnaphthalene-2-carbonyl)oxyethoxysulfonyl]-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 58571906 |
| Molecular Formula | C19H19F4O8S2- |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 515.05 |
| IUPAC Name | 2-[2-(6-butan-2-ylnaphthalene-2-carbonyl)oxyethoxysulfonyl]-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | CCC(C)c1ccc2cc(C(=O)OCCOS(=O)(=O)C(F)(F)C(F)(F)S(=O)(=O)[O-])ccc2c1 |
| InChI | InChI=1S/C19H20F4O8S2/c1-3-12(2)13-4-5-15-11-16(7-6-14(15)10-13)17(24)30-8-9-31-33(28,29)19(22,23)18(20,21)32(25,26)27/h4-7,10-12H,3,8-9H2,1-2H3,(H,25,26,27)/p-1 |
| InChIKey | GPUDBIVHGRXMMF-UHFFFAOYSA-M |
| XLogP | 3.59 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|