C22H31NNa2O6 — CID 58596463
disodium;3-(carboxylatomethyl)-3-[(4-octylphenyl)methylazaniumyl]pentanedioate (PubChem CID 58596463) has the molecular formula C22H31NNa2O6 and a molecular weight of 451.47 g/mol. Its IUPAC name is disodium;3-(carboxylatomethyl)-3-[(4-octylphenyl)methylazaniumyl]pentanedioate.
| Compound Name | disodium;3-(carboxylatomethyl)-3-[(4-octylphenyl)methylazaniumyl]pentanedioate |
|---|---|
| PubChem CID | 58596463 |
| Molecular Formula | C22H31NNa2O6 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | disodium;3-(carboxylatomethyl)-3-[(4-octylphenyl)methylazaniumyl]pentanedioate |
| SMILES | CCCCCCCCc1ccc(C[NH2+]C(CC(=O)[O-])(CC(=O)[O-])CC(=O)[O-])cc1.[Na+].[Na+] |
| InChI | InChI=1S/C22H33NO6.2Na/c1-2-3-4-5-6-7-8-17-9-11-18(12-10-17)16-23-22(13-19(24)25,14-20(26)27)15-21(28)29;;/h9-12,23H,2-8,13-16H2,1H3,(H,24,25)(H,26,27)(H,28,29);;/q;2*+1/p-2 |
| InChIKey | BCUWWQVFMZPLJW-UHFFFAOYSA-L |
| XLogP | -7.18 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | -7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|