C18H19NO2S — CID 58597414
1-(benzenesulfonyl)-3-(2-phenylethyl)-2,5-dihydropyrrole (PubChem CID 58597414) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(2-phenylethyl)-2,5-dihydropyrrole.
| Compound Name | 1-(benzenesulfonyl)-3-(2-phenylethyl)-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 58597414 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(2-phenylethyl)-2,5-dihydropyrrole |
| SMILES | O=S(=O)(c1ccccc1)N1CC=C(CCc2ccccc2)C1 |
| InChI | InChI=1S/C18H19NO2S/c20-22(21,18-9-5-2-6-10-18)19-14-13-17(15-19)12-11-16-7-3-1-4-8-16/h1-10,13H,11-12,14-15H2 |
| InChIKey | ONLQBZBJNPTZMT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|