C8H8F8O6S4-2 — CID 58616416
1,1,2,2-tetrafluoro-2-[4-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethyl)sulfanylbutylsulfanyl]ethanesulfonate (PubChem CID 58616416) has the molecular formula C8H8F8O6S4-2 and a molecular weight of 480.40 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[4-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethyl)sulfanylbutylsulfanyl]ethanesulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-2-[4-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethyl)sulfanylbutylsulfanyl]ethanesulfonate |
|---|---|
| PubChem CID | 58616416 |
| Molecular Formula | C8H8F8O6S4-2 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 479.91 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[4-(1,1,2,2-tetrafluoro-2-oxidoperoxysulfanylethyl)sulfanylbutylsulfanyl]ethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)SCCCCSC(F)(F)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C8H10F8O6S4/c9-5(10,6(11,12)25-22-21-17)23-3-1-2-4-24-7(13,14)8(15,16)26(18,19)20/h17H,1-4H2,(H,18,19,20)/p-2 |
| InChIKey | PSSZWTOCKHZQSS-UHFFFAOYSA-L |
| XLogP | 3.02 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|