C22H24F6O6 — CID 58617979
3-[4-[2-[4-(2,3-dihydroxypropoxy)-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]propane-1,2-diol (PubChem CID 58617979) has the molecular formula C22H24F6O6 and a molecular weight of 498.42 g/mol. Its IUPAC name is 3-[4-[2-[4-(2,3-dihydroxypropoxy)-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]propane-1,2-diol.
| Compound Name | 3-[4-[2-[4-(2,3-dihydroxypropoxy)-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 58617979 |
| Molecular Formula | C22H24F6O6 |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 3-[4-[2-[4-(2,3-dihydroxypropoxy)-3-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]propane-1,2-diol |
| SMILES | Cc1cc(C(c2ccc(OCC(O)CO)cc2)(C(F)(F)F)C(F)(F)F)ccc1OCC(O)CO |
| InChI | InChI=1S/C22H24F6O6/c1-13-8-15(4-7-19(13)34-12-17(32)10-30)20(21(23,24)25,22(26,27)28)14-2-5-18(6-3-14)33-11-16(31)9-29/h2-8,16-17,29-32H,9-12H2,1H3 |
| InChIKey | JXDBUIGQJFZZEI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |