C14H13FN4 — CID 58621035
3-(2-fluoroethyl)-1-(1-phenylpyrrol-3-yl)-1,2,4-triazole (PubChem CID 58621035) has the molecular formula C14H13FN4 and a molecular weight of 256.28 g/mol. Its IUPAC name is 3-(2-fluoroethyl)-1-(1-phenylpyrrol-3-yl)-1,2,4-triazole.
| Compound Name | 3-(2-fluoroethyl)-1-(1-phenylpyrrol-3-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 58621035 |
| Molecular Formula | C14H13FN4 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-(2-fluoroethyl)-1-(1-phenylpyrrol-3-yl)-1,2,4-triazole |
| SMILES | FCCc1ncn(-c2ccn(-c3ccccc3)c2)n1 |
| InChI | InChI=1S/C14H13FN4/c15-8-6-14-16-11-19(17-14)13-7-9-18(10-13)12-4-2-1-3-5-12/h1-5,7,9-11H,6,8H2 |
| InChIKey | GBRYRZQKTKVHHK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |