C28H38F2N4O6S — CID 58623216
4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-1-(2-methoxyethyl)-N-(oxan-2-yloxy)piperidine-4-carboxamide (PubChem CID 58623216) has the molecular formula C28H38F2N4O6S and a molecular weight of 596.70 g/mol. Its IUPAC name is 4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-1-(2-methoxyethyl)-N-(oxan-2-yloxy)piperidine-4-carboxamide.
| Compound Name | 4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-1-(2-methoxyethyl)-N-(oxan-2-yloxy)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 58623216 |
| Molecular Formula | C28H38F2N4O6S |
| Molecular Weight | 596.70 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-1-(2-methoxyethyl)-N-(oxan-2-yloxy)piperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NOC2CCCCO2)(S(=O)(=O)c2ccc(-c3cnc(CCC(C)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C28H38F2N4O6S/c1-27(29,30)11-10-22-19-32-24(20-31-22)21-6-8-23(9-7-21)41(36,37)28(12-14-34(15-13-28)16-18-38-2)26(35)33-40-25-5-3-4-17-39-25/h6-9,19-20,25H,3-5,10-18H2,1-2H3,(H,33,35) |
| InChIKey | LGIFDZWZGWEARV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.70 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|