C29H38F3N3O6S — CID 58623272
1-(2-methoxyethyl)-N-(oxan-2-yloxy)-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 58623272) has the molecular formula C29H38F3N3O6S and a molecular weight of 613.70 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-(oxan-2-yloxy)-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-N-(oxan-2-yloxy)-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 58623272 |
| Molecular Formula | C29H38F3N3O6S |
| Molecular Weight | 613.70 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | 1-(2-methoxyethyl)-N-(oxan-2-yloxy)-4-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NOC2CCCCO2)(S(=O)(=O)c2ccc(-c3ccc(CCCC(F)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C29H38F3N3O6S/c1-39-20-18-35-16-14-28(15-17-35,27(36)34-41-26-6-2-3-19-40-26)42(37,38)24-10-8-23(9-11-24)25-12-7-22(21-33-25)5-4-13-29(30,31)32/h7-12,21,26H,2-6,13-20H2,1H3,(H,34,36) |
| InChIKey | HURJNUCIGHFCBQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.70 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|