C38H62O2Si2 — CID 58630468
[3-[2-[3-[di(propan-2-yl)-prop-2-enylsilyl]oxy-2,3,3a,7a-tetrahydro-1H-inden-1-yl]ethyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]oxy-di(propan-2-yl)-prop-2-enylsilane (PubChem CID 58630468) has the molecular formula C38H62O2Si2 and a molecular weight of 607.08 g/mol. Its IUPAC name is [3-[2-[3-[di(propan-2-yl)-prop-2-enylsilyl]oxy-2,3,3a,7a-tetrahydro-1H-inden-1-yl]ethyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]oxy-di(propan-2-yl)-prop-2-enylsilane.
| Compound Name | [3-[2-[3-[di(propan-2-yl)-prop-2-enylsilyl]oxy-2,3,3a,7a-tetrahydro-1H-inden-1-yl]ethyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]oxy-di(propan-2-yl)-prop-2-enylsilane |
|---|---|
| PubChem CID | 58630468 |
| Molecular Formula | C38H62O2Si2 |
| Molecular Weight | 607.08 g/mol |
| Exact Mass | 606.43 |
| IUPAC Name | [3-[2-[3-[di(propan-2-yl)-prop-2-enylsilyl]oxy-2,3,3a,7a-tetrahydro-1H-inden-1-yl]ethyl]-2,3,3a,7a-tetrahydro-1H-inden-1-yl]oxy-di(propan-2-yl)-prop-2-enylsilane |
| SMILES | C=CC[Si](OC1CC(CCC2CC(O[Si](CC=C)(C(C)C)C(C)C)C3C=CC=CC23)C2C=CC=CC12)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H62O2Si2/c1-11-23-41(27(3)4,28(5)6)39-37-25-31(33-17-13-15-19-35(33)37)21-22-32-26-38(36-20-16-14-18-34(32)36)40-42(24-12-2,29(7)8)30(9)10/h11-20,27-38H,1-2,21-26H2,3-10H3 |
| InChIKey | GPHODRYBIMFWLR-UHFFFAOYSA-N |
| XLogP | 11.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.08 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|