C33H33Cl2N2O3S3+ — CID 58633608
5-chloro-2-[2-[[5-chloro-3-(4-phenylbutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azolidin-1-ium]-2'-sulfonate (PubChem CID 58633608) has the molecular formula C33H33Cl2N2O3S3+ and a molecular weight of 672.75 g/mol. Its IUPAC name is 5-chloro-2-[2-[[5-chloro-3-(4-phenylbutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azolidin-1-ium]-2'-sulfonate.
| Compound Name | 5-chloro-2-[2-[[5-chloro-3-(4-phenylbutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azolidin-1-ium]-2'-sulfonate |
|---|---|
| PubChem CID | 58633608 |
| Molecular Formula | C33H33Cl2N2O3S3+ |
| Molecular Weight | 672.75 g/mol |
| Exact Mass | 671.10 |
| IUPAC Name | 5-chloro-2-[2-[[5-chloro-3-(4-phenylbutyl)-1,3-benzothiazol-3-ium-2-yl]methylidene]butylidene]spiro[1,3-benzothiazol-3-ium-3,1'-azolidin-1-ium]-2'-sulfonate |
| SMILES | CCC(=Cc1sc2ccc(Cl)cc2[n+]1CCCCc1ccccc1)C=C1Sc2ccc(Cl)cc2[N+]12CCCC2S(=O)(=O)[O-] |
| InChI | InChI=1S/C33H33Cl2N2O3S3/c1-2-23(20-32-37(18-8-12-33(37)43(38,39)40)28-22-26(35)14-16-30(28)42-32)19-31-36(27-21-25(34)13-15-29(27)41-31)17-7-6-11-24-9-4-3-5-10-24/h3-5,9-10,13-16,19-22,33H,2,6-8,11-12,17-18H2,1H3/q+1 |
| InChIKey | PJQROTVMTMBDON-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.75 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|