C15H19N6O+ — CID 58635546
2-[[6-(benzylamino)-9-methyl-7H-purin-9-ium-2-yl]amino]ethanol (PubChem CID 58635546) has the molecular formula C15H19N6O+ and a molecular weight of 299.36 g/mol. Its IUPAC name is 2-[[6-(benzylamino)-9-methyl-7H-purin-9-ium-2-yl]amino]ethanol.
| Compound Name | 2-[[6-(benzylamino)-9-methyl-7H-purin-9-ium-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 58635546 |
| Molecular Formula | C15H19N6O+ |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-[[6-(benzylamino)-9-methyl-7H-purin-9-ium-2-yl]amino]ethanol |
| SMILES | C[n+]1c[nH]c2c(NCc3ccccc3)nc(NCCO)nc21 |
| InChI | InChI=1S/C15H18N6O/c1-21-10-18-12-13(17-9-11-5-3-2-4-6-11)19-15(16-7-8-22)20-14(12)21/h2-6,10,22H,7-9H2,1H3,(H2,16,17,19,20)/p+1 |
| InChIKey | GTVPOLSIJWJJNY-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 89.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|