C23H22F2N2O2S2 — CID 58642256
(5Z)-5-[1-[3-(3,4-difluorophenyl)phenyl]-4-morpholin-4-ylbutylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 58642256) has the molecular formula C23H22F2N2O2S2 and a molecular weight of 460.57 g/mol. Its IUPAC name is (5Z)-5-[1-[3-(3,4-difluorophenyl)phenyl]-4-morpholin-4-ylbutylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[1-[3-(3,4-difluorophenyl)phenyl]-4-morpholin-4-ylbutylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58642256 |
| Molecular Formula | C23H22F2N2O2S2 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | (5Z)-5-[1-[3-(3,4-difluorophenyl)phenyl]-4-morpholin-4-ylbutylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C(/CCCN1CCOCC1)c1cccc(-c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C23H22F2N2O2S2/c24-19-7-6-16(14-20(19)25)15-3-1-4-17(13-15)18(21-22(28)26-23(30)31-21)5-2-8-27-9-11-29-12-10-27/h1,3-4,6-7,13-14H,2,5,8-12H2,(H,26,28,30)/b21-18- |
| InChIKey | RKFYXFZKHAWPHO-UZYVYHOESA-N |
| XLogP | 4.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|