C25H22F6N2O3S — CID 58643811
(5Z)-5-[1-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-4-morpholin-4-ylbutylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 58643811) has the molecular formula C25H22F6N2O3S and a molecular weight of 544.52 g/mol. Its IUPAC name is (5Z)-5-[1-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-4-morpholin-4-ylbutylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[1-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-4-morpholin-4-ylbutylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 58643811 |
| Molecular Formula | C25H22F6N2O3S |
| Molecular Weight | 544.52 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | (5Z)-5-[1-[3-[3,5-bis(trifluoromethyl)phenyl]phenyl]-4-morpholin-4-ylbutylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C(\CCCN2CCOCC2)c2cccc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)S1 |
| InChI | InChI=1S/C25H22F6N2O3S/c26-24(27,28)18-12-17(13-19(14-18)25(29,30)31)15-3-1-4-16(11-15)20(21-22(34)32-23(35)37-21)5-2-6-33-7-9-36-10-8-33/h1,3-4,11-14H,2,5-10H2,(H,32,34,35)/b21-20- |
| InChIKey | WDCBIIUYXFARIX-MRCUWXFGSA-N |
| XLogP | 6.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|