C9H13N5OS2 — CID 58643266
2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one (PubChem CID 58643266) has the molecular formula C9H13N5OS2 and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 58643266 |
| Molecular Formula | C9H13N5OS2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-sulfanylidene-3-[5-(2H-tetrazol-5-yl)pentyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=S)N1CCCCCc1nn[nH]n1 |
| InChI | InChI=1S/C9H13N5OS2/c15-8-6-17-9(16)14(8)5-3-1-2-4-7-10-12-13-11-7/h1-6H2,(H,10,11,12,13) |
| InChIKey | KRRACXHBHZGKJP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|